C14H10N4S — CID 79295565
4-methyl-3-(2-sulfanylidene-3H-imidazo[4,5-c]pyridin-1-yl)benzonitrile (PubChem CID 79295565) has the molecular formula C14H10N4S and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-methyl-3-(2-sulfanylidene-3H-imidazo[4,5-c]pyridin-1-yl)benzonitrile.
| Compound Name | 4-methyl-3-(2-sulfanylidene-3H-imidazo[4,5-c]pyridin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 79295565 |
| Molecular Formula | C14H10N4S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-methyl-3-(2-sulfanylidene-3H-imidazo[4,5-c]pyridin-1-yl)benzonitrile |
| SMILES | Cc1ccc(C#N)cc1-n1c(=S)[nH]c2cnccc21 |
| InChI | InChI=1S/C14H10N4S/c1-9-2-3-10(7-15)6-13(9)18-12-4-5-16-8-11(12)17-14(18)19/h2-6,8H,1H3,(H,17,19) |
| InChIKey | QGDWKEMPRRFABX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|