About 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine
1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine (PubChem CID 79298060) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine |
| PubChem CID | 79298060 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine |
| SMILES | CNC(C(C)C)C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C12H25NO/c1-9(2)11(13-5)10-6-7-14-12(3,4)8-10/h9-11,13H,6-8H2,1-5H3 |
| InChIKey | GUTLVRPJJDAFIN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine?
The IUPAC name of 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine (CID 79298060) is 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine?
The canonical SMILES for 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine is CNC(C(C)C)C1CCOC(C)(C)C1.
What is the InChIKey of 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine?
The InChIKey is GUTLVRPJJDAFIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-9(2)11(13-5)10-6-7-14-12(3,4)8-10/h9-11,13H,6-8H2,1-5H3.
What are the key properties of 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine?
1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine has a molecular weight of 199.34 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethyloxan-4-yl)-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 79298060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).