C13H20BrN — CID 79298620
2-(4-bromophenyl)-N,4-dimethylpentan-3-amine (PubChem CID 79298620) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N,4-dimethylpentan-3-amine.
| Compound Name | 2-(4-bromophenyl)-N,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 79298620 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-(4-bromophenyl)-N,4-dimethylpentan-3-amine |
| SMILES | CNC(C(C)C)C(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H20BrN/c1-9(2)13(15-4)10(3)11-5-7-12(14)8-6-11/h5-10,13,15H,1-4H3 |
| InChIKey | QAEICCLHUKAALR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |