About 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine
3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine (PubChem CID 79299995) has the molecular formula C13H18N6S
and a molecular weight of 290.40 g/mol. Its IUPAC name is 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine.
Molecular Properties
| Compound Name | 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine |
| PubChem CID | 79299995 |
| Molecular Formula | C13H18N6S |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine |
| SMILES | CCc1nn(C)c2c1nc(N)n2C(CC)c1nccs1 |
| InChI | InChI=1S/C13H18N6S/c1-4-8-10-12(18(3)17-8)19(13(14)16-10)9(5-2)11-15-6-7-20-11/h6-7,9H,4-5H2,1-3H3,(H2,14,16) |
| InChIKey | FBFBVYXORAWNDB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine?
The IUPAC name of 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine (CID 79299995) is 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine.
What is the SMILES notation for 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine?
The canonical SMILES for 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine is CCc1nn(C)c2c1nc(N)n2C(CC)c1nccs1.
What is the InChIKey of 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine?
The InChIKey is FBFBVYXORAWNDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N6S/c1-4-8-10-12(18(3)17-8)19(13(14)16-10)9(5-2)11-15-6-7-20-11/h6-7,9H,4-5H2,1-3H3,(H2,14,16).
What are the key properties of 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine?
3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine has a molecular weight of 290.40 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-6-[1-(1,3-thiazol-2-yl)propyl]imidazo[4,5-d]pyrazol-5-amine is sourced from PubChem (CID 79299995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).