C14H18ClN5S — CID 79281214
2-[1-[5-(chloromethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]propyl]-1,3-thiazole (PubChem CID 79281214) has the molecular formula C14H18ClN5S and a molecular weight of 323.85 g/mol. Its IUPAC name is 2-[1-[5-(chloromethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]propyl]-1,3-thiazole.
| Compound Name | 2-[1-[5-(chloromethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79281214 |
| Molecular Formula | C14H18ClN5S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-[1-[5-(chloromethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]propyl]-1,3-thiazole |
| SMILES | CCc1nn(C)c2c1nc(CCl)n2C(CC)c1nccs1 |
| InChI | InChI=1S/C14H18ClN5S/c1-4-9-12-14(19(3)18-9)20(11(8-15)17-12)10(5-2)13-16-6-7-21-13/h6-7,10H,4-5,8H2,1-3H3 |
| InChIKey | VFSZBZNWMMHEMN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|