C12H21N3O2S2 — CID 79303073
4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-N-methylthiophene-2-sulfonamide (PubChem CID 79303073) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | 4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79303073 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-N-methylthiophene-2-sulfonamide |
| SMILES | CCN1CCCC1CN(C)S(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-3-15-6-4-5-11(15)8-14(2)19(16,17)12-7-10(13)9-18-12/h7,9,11H,3-6,8,13H2,1-2H3 |
| InChIKey | GAIAFHWGBNYEIQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |