C13H20BrClN2O2S2 — CID 79308837
2-bromo-5-(chloromethyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]-N-methylthiophene-3-sulfonamide (PubChem CID 79308837) has the molecular formula C13H20BrClN2O2S2 and a molecular weight of 415.81 g/mol. Its IUPAC name is 2-bromo-5-(chloromethyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]-N-methylthiophene-3-sulfonamide.
| Compound Name | 2-bromo-5-(chloromethyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]-N-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 79308837 |
| Molecular Formula | C13H20BrClN2O2S2 |
| Molecular Weight | 415.81 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 2-bromo-5-(chloromethyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]-N-methylthiophene-3-sulfonamide |
| SMILES | CCN1CCCC1CN(C)S(=O)(=O)c1cc(CCl)sc1Br |
| InChI | InChI=1S/C13H20BrClN2O2S2/c1-3-17-6-4-5-10(17)9-16(2)21(18,19)12-7-11(8-15)20-13(12)14/h7,10H,3-6,8-9H2,1-2H3 |
| InChIKey | USWVUNXKHFJCJJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.81 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|