C17H28BrN3O2S — CID 60620479
2-bromo-N-[2-(dimethylamino)ethyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzenesulfonamide (PubChem CID 60620479) has the molecular formula C17H28BrN3O2S and a molecular weight of 418.40 g/mol. Its IUPAC name is 2-bromo-N-[2-(dimethylamino)ethyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[2-(dimethylamino)ethyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60620479 |
| Molecular Formula | C17H28BrN3O2S |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-bromo-N-[2-(dimethylamino)ethyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzenesulfonamide |
| SMILES | CCN1CCCC1CN(CCN(C)C)S(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C17H28BrN3O2S/c1-4-20-11-7-8-15(20)14-21(13-12-19(2)3)24(22,23)17-10-6-5-9-16(17)18/h5-6,9-10,15H,4,7-8,11-14H2,1-3H3 |
| InChIKey | IDDBXAPBDJRKHM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |