C18H28N4O2S — CID 51132572
3-cyano-N-[2-(dimethylamino)ethyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzenesulfonamide (PubChem CID 51132572) has the molecular formula C18H28N4O2S and a molecular weight of 364.52 g/mol. Its IUPAC name is 3-cyano-N-[2-(dimethylamino)ethyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[2-(dimethylamino)ethyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51132572 |
| Molecular Formula | C18H28N4O2S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-cyano-N-[2-(dimethylamino)ethyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzenesulfonamide |
| SMILES | CCN1CCCC1CN(CCN(C)C)S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C18H28N4O2S/c1-4-21-10-6-8-17(21)15-22(12-11-20(2)3)25(23,24)18-9-5-7-16(13-18)14-19/h5,7,9,13,17H,4,6,8,10-12,15H2,1-3H3 |
| InChIKey | BKDHMMOMMWUYGG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |