C15H25ClN4 — CID 79307838
5-(chloromethyl)-1-ethyl-3-methyl-6-(4-methylhexan-2-yl)imidazo[4,5-d]pyrazole (PubChem CID 79307838) has the molecular formula C15H25ClN4 and a molecular weight of 296.85 g/mol. Its IUPAC name is 5-(chloromethyl)-1-ethyl-3-methyl-6-(4-methylhexan-2-yl)imidazo[4,5-d]pyrazole.
| Compound Name | 5-(chloromethyl)-1-ethyl-3-methyl-6-(4-methylhexan-2-yl)imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79307838 |
| Molecular Formula | C15H25ClN4 |
| Molecular Weight | 296.85 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 5-(chloromethyl)-1-ethyl-3-methyl-6-(4-methylhexan-2-yl)imidazo[4,5-d]pyrazole |
| SMILES | CCC(C)CC(C)n1c(CCl)nc2c(C)nn(CC)c21 |
| InChI | InChI=1S/C15H25ClN4/c1-6-10(3)8-11(4)20-13(9-16)17-14-12(5)18-19(7-2)15(14)20/h10-11H,6-9H2,1-5H3 |
| InChIKey | XFXFUXATPUCLNR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|