C15H21Br — CID 79308414
1-(1-bromopropyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene (PubChem CID 79308414) has the molecular formula C15H21Br and a molecular weight of 281.24 g/mol. Its IUPAC name is 1-(1-bromopropyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene.
| Compound Name | 1-(1-bromopropyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 79308414 |
| Molecular Formula | C15H21Br |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-(1-bromopropyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene |
| SMILES | CCC(Br)C1CCC(C)(C)c2ccccc21 |
| InChI | InChI=1S/C15H21Br/c1-4-14(16)12-9-10-15(2,3)13-8-6-5-7-11(12)13/h5-8,12,14H,4,9-10H2,1-3H3 |
| InChIKey | SFTDJILELDOCBS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|