About N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine
N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine (PubChem CID 79308584) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine.
Molecular Properties
| Compound Name | N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine |
| PubChem CID | 79308584 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine |
| SMILES | CCC(NC)C1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H27N/c1-6-12(14-5)11-7-10(2)8-13(3,4)9-11/h10-12,14H,6-9H2,1-5H3 |
| InChIKey | HNFRIERCSLKNKV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine?
The IUPAC name of N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine (CID 79308584) is N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine.
What is the SMILES notation for N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine?
The canonical SMILES for N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine is CCC(NC)C1CC(C)CC(C)(C)C1.
What is the InChIKey of N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine?
The InChIKey is HNFRIERCSLKNKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-6-12(14-5)11-7-10(2)8-13(3,4)9-11/h10-12,14H,6-9H2,1-5H3.
What are the key properties of N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine?
N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine has a molecular weight of 197.37 g/mol, XLogP of 3.45, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(3,3,5-trimethylcyclohexyl)propan-1-amine is sourced from PubChem (CID 79308584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).