C11H20ClNO — CID 123554977
2-chloro-2-(3,3,5-trimethylcyclohexyl)acetamide (PubChem CID 123554977) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is 2-chloro-2-(3,3,5-trimethylcyclohexyl)acetamide.
| Compound Name | 2-chloro-2-(3,3,5-trimethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 123554977 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-chloro-2-(3,3,5-trimethylcyclohexyl)acetamide |
| SMILES | CC1CC(C(Cl)C(N)=O)CC(C)(C)C1 |
| InChI | InChI=1S/C11H20ClNO/c1-7-4-8(9(12)10(13)14)6-11(2,3)5-7/h7-9H,4-6H2,1-3H3,(H2,13,14) |
| InChIKey | CVLOWSMPAHUNHZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|