C15H23ClN2O2S — CID 79308821
3-(chloromethyl)-N,4-dimethyl-N-[(1-methylpyrrolidin-2-yl)methyl]benzenesulfonamide (PubChem CID 79308821) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is 3-(chloromethyl)-N,4-dimethyl-N-[(1-methylpyrrolidin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-(chloromethyl)-N,4-dimethyl-N-[(1-methylpyrrolidin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 79308821 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-(chloromethyl)-N,4-dimethyl-N-[(1-methylpyrrolidin-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC2CCCN2C)cc1CCl |
| InChI | InChI=1S/C15H23ClN2O2S/c1-12-6-7-15(9-13(12)10-16)21(19,20)18(3)11-14-5-4-8-17(14)2/h6-7,9,14H,4-5,8,10-11H2,1-3H3 |
| InChIKey | TXOJCGIJIHUUOU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|