C14H20ClFN2O2S — CID 79312296
5-(chloromethyl)-2-fluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]benzenesulfonamide (PubChem CID 79312296) has the molecular formula C14H20ClFN2O2S and a molecular weight of 334.84 g/mol. Its IUPAC name is 5-(chloromethyl)-2-fluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 5-(chloromethyl)-2-fluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 79312296 |
| Molecular Formula | C14H20ClFN2O2S |
| Molecular Weight | 334.84 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 5-(chloromethyl)-2-fluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]benzenesulfonamide |
| SMILES | CN1CCCC1CN(C)S(=O)(=O)c1cc(CCl)ccc1F |
| InChI | InChI=1S/C14H20ClFN2O2S/c1-17-7-3-4-12(17)10-18(2)21(19,20)14-8-11(9-15)5-6-13(14)16/h5-6,8,12H,3-4,7,9-10H2,1-2H3 |
| InChIKey | KGTSNQJTDGCIRP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.84 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|