C14H19ClF2N2 — CID 79319880
4-(chloromethyl)-2,6-difluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline (PubChem CID 79319880) has the molecular formula C14H19ClF2N2 and a molecular weight of 288.77 g/mol. Its IUPAC name is 4-(chloromethyl)-2,6-difluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline.
| Compound Name | 4-(chloromethyl)-2,6-difluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 79319880 |
| Molecular Formula | C14H19ClF2N2 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 4-(chloromethyl)-2,6-difluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline |
| SMILES | CN(CC1CCCN1C)c1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C14H19ClF2N2/c1-18-5-3-4-11(18)9-19(2)14-12(16)6-10(8-15)7-13(14)17/h6-7,11H,3-5,8-9H2,1-2H3 |
| InChIKey | KNBOHBVXADRRPJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|