C13H11IN4O3 — CID 79310613
1-[1-(3-iodobenzoyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79310613) has the molecular formula C13H11IN4O3 and a molecular weight of 398.16 g/mol. Its IUPAC name is 1-[1-(3-iodobenzoyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(3-iodobenzoyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79310613 |
| Molecular Formula | C13H11IN4O3 |
| Molecular Weight | 398.16 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 1-[1-(3-iodobenzoyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CN(C(=O)c3cccc(I)c3)C2)nn1 |
| InChI | InChI=1S/C13H11IN4O3/c14-9-3-1-2-8(4-9)12(19)17-5-10(6-17)18-7-11(13(20)21)15-16-18/h1-4,7,10H,5-6H2,(H,20,21) |
| InChIKey | ACAABSODNMVFQW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|