C13H26N2O2 — CID 79314027
6-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]hexanoic acid (PubChem CID 79314027) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 6-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]hexanoic acid.
| Compound Name | 6-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 79314027 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 6-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]hexanoic acid |
| SMILES | CN(CCCCCC(=O)O)CC1CCCN1C |
| InChI | InChI=1S/C13H26N2O2/c1-14(9-5-3-4-8-13(16)17)11-12-7-6-10-15(12)2/h12H,3-11H2,1-2H3,(H,16,17) |
| InChIKey | MGGVDRFICXTAIK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|