C12H24N2O2 — CID 79313620
methyl 4-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]butanoate (PubChem CID 79313620) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is methyl 4-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]butanoate.
| Compound Name | methyl 4-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]butanoate |
|---|---|
| PubChem CID | 79313620 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | methyl 4-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]butanoate |
| SMILES | COC(=O)CCCN(C)CC1CCCN1C |
| InChI | InChI=1S/C12H24N2O2/c1-13(8-5-7-12(15)16-3)10-11-6-4-9-14(11)2/h11H,4-10H2,1-3H3 |
| InChIKey | HUHDBHYFDVVMQI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |