C13H29N3 — CID 79312803
N-butyl-N'-methyl-N'-[(1-methylpyrrolidin-2-yl)methyl]ethane-1,2-diamine (PubChem CID 79312803) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is N-butyl-N'-methyl-N'-[(1-methylpyrrolidin-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N-butyl-N'-methyl-N'-[(1-methylpyrrolidin-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 79312803 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | N-butyl-N'-methyl-N'-[(1-methylpyrrolidin-2-yl)methyl]ethane-1,2-diamine |
| SMILES | CCCCNCCN(C)CC1CCCN1C |
| InChI | InChI=1S/C13H29N3/c1-4-5-8-14-9-11-15(2)12-13-7-6-10-16(13)3/h13-14H,4-12H2,1-3H3 |
| InChIKey | QLSSGXCTCCSIDG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|