C11H22F3N3 — CID 79318682
N'-methyl-N'-[(1-methylpyrrolidin-2-yl)methyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 79318682) has the molecular formula C11H22F3N3 and a molecular weight of 253.31 g/mol. Its IUPAC name is N'-methyl-N'-[(1-methylpyrrolidin-2-yl)methyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-[(1-methylpyrrolidin-2-yl)methyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79318682 |
| Molecular Formula | C11H22F3N3 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N'-methyl-N'-[(1-methylpyrrolidin-2-yl)methyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCC(F)(F)F)CC1CCCN1C |
| InChI | InChI=1S/C11H22F3N3/c1-16(7-5-15-9-11(12,13)14)8-10-4-3-6-17(10)2/h10,15H,3-9H2,1-2H3 |
| InChIKey | YVMNOAWHAWKJKC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|