C18H21NO5 — CID 7932367
[(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] (1S)-cyclohex-3-ene-1-carboxylate (PubChem CID 7932367) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] (1S)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] (1S)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7932367 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] (1S)-cyclohex-3-ene-1-carboxylate |
| SMILES | C[C@H](OC(=O)[C@@H]1CC=CCC1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H21NO5/c1-12(24-18(21)14-5-3-2-4-6-14)17(20)19-10-13-7-8-15-16(9-13)23-11-22-15/h2-3,7-9,12,14H,4-6,10-11H2,1H3,(H,19,20)/t12-,14+/m0/s1 |
| InChIKey | PEJPEKUIDLKMIC-GXTWGEPZSA-N |
| XLogP | 2.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|