C16H19NO3 — CID 78801154
N-(1,3-benzodioxol-5-ylmethyl)-N-methylcyclohex-3-ene-1-carboxamide (PubChem CID 78801154) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-methylcyclohex-3-ene-1-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-methylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 78801154 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-methylcyclohex-3-ene-1-carboxamide |
| SMILES | CN(Cc1ccc2c(c1)OCO2)C(=O)C1CC=CCC1 |
| InChI | InChI=1S/C16H19NO3/c1-17(16(18)13-5-3-2-4-6-13)10-12-7-8-14-15(9-12)20-11-19-14/h2-3,7-9,13H,4-6,10-11H2,1H3 |
| InChIKey | XYQQNTOBPUEKMP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|