C17H23N3O3 — CID 73250913
N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 73250913) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 73250913 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | CN(Cc1ccc2c(c1)OCO2)C(=O)C1NNC2CCCCC21 |
| InChI | InChI=1S/C17H23N3O3/c1-20(9-11-6-7-14-15(8-11)23-10-22-14)17(21)16-12-4-2-3-5-13(12)18-19-16/h6-8,12-13,16,18-19H,2-5,9-10H2,1H3 |
| InChIKey | RIDWEKZCTRGGJG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |