C15H19NO2 — CID 53412236
N-(1,3-benzodioxol-5-ylmethyl)-N-methylcyclohex-3-en-1-amine (PubChem CID 53412236) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-methylcyclohex-3-en-1-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-methylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 53412236 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-methylcyclohex-3-en-1-amine |
| SMILES | CN(Cc1ccc2c(c1)OCO2)C1CC=CCC1 |
| InChI | InChI=1S/C15H19NO2/c1-16(13-5-3-2-4-6-13)10-12-7-8-14-15(9-12)18-11-17-14/h2-3,7-9,13H,4-6,10-11H2,1H3 |
| InChIKey | SMSMEWSBUSSHPM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|