C12H10BrNO2 — CID 79324593
3-(4-bromo-3-methylphenyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 79324593) has the molecular formula C12H10BrNO2 and a molecular weight of 280.12 g/mol. Its IUPAC name is 3-(4-bromo-3-methylphenyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-(4-bromo-3-methylphenyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79324593 |
| Molecular Formula | C12H10BrNO2 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 3-(4-bromo-3-methylphenyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cc(-c2cc[nH]c2C(=O)O)ccc1Br |
| InChI | InChI=1S/C12H10BrNO2/c1-7-6-8(2-3-10(7)13)9-4-5-14-11(9)12(15)16/h2-6,14H,1H3,(H,15,16) |
| InChIKey | OYZDTSYXKJARDJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |