C13H13NO2 — CID 79324740
3-(2,4-dimethylphenyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 79324740) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-(2,4-dimethylphenyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79324740 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1ccc(-c2cc[nH]c2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C13H13NO2/c1-8-3-4-10(9(2)7-8)11-5-6-14-12(11)13(15)16/h3-7,14H,1-2H3,(H,15,16) |
| InChIKey | OSVVMZDQSWYUCH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |