C9H9F2NOS — CID 79327262
3,5-difluoro-4-(oxetan-3-ylsulfanyl)aniline (PubChem CID 79327262) has the molecular formula C9H9F2NOS and a molecular weight of 217.24 g/mol. Its IUPAC name is 3,5-difluoro-4-(oxetan-3-ylsulfanyl)aniline.
| Compound Name | 3,5-difluoro-4-(oxetan-3-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 79327262 |
| Molecular Formula | C9H9F2NOS |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 3,5-difluoro-4-(oxetan-3-ylsulfanyl)aniline |
| SMILES | Nc1cc(F)c(SC2COC2)c(F)c1 |
| InChI | InChI=1S/C9H9F2NOS/c10-7-1-5(12)2-8(11)9(7)14-6-3-13-4-6/h1-2,6H,3-4,12H2 |
| InChIKey | QZYOCKWPSJWGTG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|