C15H20FNO2S — CID 79906293
4-(1,9-dioxaspiro[5.5]undecan-4-ylsulfanyl)-3-fluoroaniline (PubChem CID 79906293) has the molecular formula C15H20FNO2S and a molecular weight of 297.39 g/mol. Its IUPAC name is 4-(1,9-dioxaspiro[5.5]undecan-4-ylsulfanyl)-3-fluoroaniline.
| Compound Name | 4-(1,9-dioxaspiro[5.5]undecan-4-ylsulfanyl)-3-fluoroaniline |
|---|---|
| PubChem CID | 79906293 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-(1,9-dioxaspiro[5.5]undecan-4-ylsulfanyl)-3-fluoroaniline |
| SMILES | Nc1ccc(SC2CCOC3(CCOCC3)C2)c(F)c1 |
| InChI | InChI=1S/C15H20FNO2S/c16-13-9-11(17)1-2-14(13)20-12-3-6-19-15(10-12)4-7-18-8-5-15/h1-2,9,12H,3-8,10,17H2 |
| InChIKey | OLRYQDUAVNQTPM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|