C15H20O3S — CID 79911996
4-(1,9-dioxaspiro[5.5]undecan-4-ylsulfanyl)phenol (PubChem CID 79911996) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 4-(1,9-dioxaspiro[5.5]undecan-4-ylsulfanyl)phenol.
| Compound Name | 4-(1,9-dioxaspiro[5.5]undecan-4-ylsulfanyl)phenol |
|---|---|
| PubChem CID | 79911996 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-(1,9-dioxaspiro[5.5]undecan-4-ylsulfanyl)phenol |
| SMILES | Oc1ccc(SC2CCOC3(CCOCC3)C2)cc1 |
| InChI | InChI=1S/C15H20O3S/c16-12-1-3-13(4-2-12)19-14-5-8-18-15(11-14)6-9-17-10-7-15/h1-4,14,16H,5-11H2 |
| InChIKey | RHKHROMDICPNHG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |