C15H20O3S — CID 79922433
[3-(2,6-dioxaspiro[4.5]decan-9-ylsulfanyl)phenyl]methanol (PubChem CID 79922433) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is [3-(2,6-dioxaspiro[4.5]decan-9-ylsulfanyl)phenyl]methanol.
| Compound Name | [3-(2,6-dioxaspiro[4.5]decan-9-ylsulfanyl)phenyl]methanol |
|---|---|
| PubChem CID | 79922433 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [3-(2,6-dioxaspiro[4.5]decan-9-ylsulfanyl)phenyl]methanol |
| SMILES | OCc1cccc(SC2CCOC3(CCOC3)C2)c1 |
| InChI | InChI=1S/C15H20O3S/c16-10-12-2-1-3-13(8-12)19-14-4-6-18-15(9-14)5-7-17-11-15/h1-3,8,14,16H,4-7,9-11H2 |
| InChIKey | NJCZMGPYBXDTFK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |