C16H23NOS2 — CID 79922948
[3-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfanyl)phenyl]methanamine (PubChem CID 79922948) has the molecular formula C16H23NOS2 and a molecular weight of 309.50 g/mol. Its IUPAC name is [3-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfanyl)phenyl]methanamine.
| Compound Name | [3-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfanyl)phenyl]methanamine |
|---|---|
| PubChem CID | 79922948 |
| Molecular Formula | C16H23NOS2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [3-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfanyl)phenyl]methanamine |
| SMILES | NCc1cccc(SC2CCOC3(CCSCC3)C2)c1 |
| InChI | InChI=1S/C16H23NOS2/c17-12-13-2-1-3-14(10-13)20-15-4-7-18-16(11-15)5-8-19-9-6-16/h1-3,10,15H,4-9,11-12,17H2 |
| InChIKey | ZDJUZRKNBRTHDA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |