C16H22O2S2 — CID 79922560
1-[3-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)phenyl]ethanol (PubChem CID 79922560) has the molecular formula C16H22O2S2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 1-[3-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)phenyl]ethanol.
| Compound Name | 1-[3-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 79922560 |
| Molecular Formula | C16H22O2S2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-[3-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)phenyl]ethanol |
| SMILES | CC(O)c1cccc(SC2CCOC3(CCSC3)C2)c1 |
| InChI | InChI=1S/C16H22O2S2/c1-12(17)13-3-2-4-14(9-13)20-15-5-7-18-16(10-15)6-8-19-11-16/h2-4,9,12,15,17H,5-8,10-11H2,1H3 |
| InChIKey | MUSQUVQQQQYLKQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |