C13H16O3S3 — CID 79904240
4-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)thiophene-2-carboxylic acid (PubChem CID 79904240) has the molecular formula C13H16O3S3 and a molecular weight of 316.47 g/mol. Its IUPAC name is 4-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)thiophene-2-carboxylic acid.
| Compound Name | 4-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79904240 |
| Molecular Formula | C13H16O3S3 |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(SC2CCOC3(CCSC3)C2)cs1 |
| InChI | InChI=1S/C13H16O3S3/c14-12(15)11-5-10(7-18-11)19-9-1-3-16-13(6-9)2-4-17-8-13/h5,7,9H,1-4,6,8H2,(H,14,15) |
| InChIKey | DNSIFONZMQVBQS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |