C13H21NO4S2 — CID 79906053
2-formamido-4-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)butanoic acid (PubChem CID 79906053) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-formamido-4-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)butanoic acid.
| Compound Name | 2-formamido-4-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 79906053 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-formamido-4-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)butanoic acid |
| SMILES | O=CNC(CCSC1CCOC2(CCSC2)C1)C(=O)O |
| InChI | InChI=1S/C13H21NO4S2/c15-9-14-11(12(16)17)2-5-20-10-1-4-18-13(7-10)3-6-19-8-13/h9-11H,1-8H2,(H,14,15)(H,16,17) |
| InChIKey | WOYFYBRZBIGYGU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|