C12H23NOS2 — CID 79906078
2-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)propan-2-amine (PubChem CID 79906078) has the molecular formula C12H23NOS2 and a molecular weight of 261.46 g/mol. Its IUPAC name is 2-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)propan-2-amine.
| Compound Name | 2-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 79906078 |
| Molecular Formula | C12H23NOS2 |
| Molecular Weight | 261.46 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfanyl)propan-2-amine |
| SMILES | CC(C)(N)CSC1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C12H23NOS2/c1-11(2,13)8-16-10-3-5-14-12(7-10)4-6-15-9-12/h10H,3-9,13H2,1-2H3 |
| InChIKey | XVIKNAQHKJJZKL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |