C12H21NO3S2 — CID 79906197
(2R)-2-amino-3-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfanyl)propanoic acid (PubChem CID 79906197) has the molecular formula C12H21NO3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (2R)-2-amino-3-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 79906197 |
| Molecular Formula | C12H21NO3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (2R)-2-amino-3-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfanyl)propanoic acid |
| SMILES | N[C@@H](CSC1CCOC2(CCSCC2)C1)C(=O)O |
| InChI | InChI=1S/C12H21NO3S2/c13-10(11(14)15)8-18-9-1-4-16-12(7-9)2-5-17-6-3-12/h9-10H,1-8,13H2,(H,14,15)/t9?,10-/m0/s1 |
| InChIKey | DHOSRHCXLFGTKD-AXDSSHIGSA-N |
| XLogP | 1.58 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |