About 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine
2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine (PubChem CID 79328718) has the molecular formula C17H21FN2S
and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine.
Molecular Properties
| Compound Name | 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine |
| PubChem CID | 79328718 |
| Molecular Formula | C17H21FN2S |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine |
| SMILES | CCCNCC(=Cc1csc(-c2ccc(F)cc2)n1)CC |
| InChI | InChI=1S/C17H21FN2S/c1-3-9-19-11-13(4-2)10-16-12-21-17(20-16)14-5-7-15(18)8-6-14/h5-8,10,12,19H,3-4,9,11H2,1-2H3 |
| InChIKey | UKJHGMGHQHZDKW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine?
The IUPAC name of 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine (CID 79328718) is 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine.
What is the SMILES notation for 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine?
The canonical SMILES for 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine is CCCNCC(=Cc1csc(-c2ccc(F)cc2)n1)CC.
What is the InChIKey of 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine?
The InChIKey is UKJHGMGHQHZDKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FN2S/c1-3-9-19-11-13(4-2)10-16-12-21-17(20-16)14-5-7-15(18)8-6-14/h5-8,10,12,19H,3-4,9,11H2,1-2H3.
What are the key properties of 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine?
2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine has a molecular weight of 304.43 g/mol, XLogP of 4.74, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methylidene]-N-propylbutan-1-amine is sourced from PubChem (CID 79328718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).