C14H10BrClN2OS — CID 79335923
3-amino-6-(2-bromophenyl)sulfanyl-5-chloro-1,3-dihydroindol-2-one (PubChem CID 79335923) has the molecular formula C14H10BrClN2OS and a molecular weight of 369.67 g/mol. Its IUPAC name is 3-amino-6-(2-bromophenyl)sulfanyl-5-chloro-1,3-dihydroindol-2-one.
| Compound Name | 3-amino-6-(2-bromophenyl)sulfanyl-5-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79335923 |
| Molecular Formula | C14H10BrClN2OS |
| Molecular Weight | 369.67 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | 3-amino-6-(2-bromophenyl)sulfanyl-5-chloro-1,3-dihydroindol-2-one |
| SMILES | NC1C(=O)Nc2cc(Sc3ccccc3Br)c(Cl)cc21 |
| InChI | InChI=1S/C14H10BrClN2OS/c15-8-3-1-2-4-11(8)20-12-6-10-7(5-9(12)16)13(17)14(19)18-10/h1-6,13H,17H2,(H,18,19) |
| InChIKey | JYJYWOXCGZEBAH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.67 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |