C11H13BrN2O2S — CID 79345087
3-amino-5-bromo-6-(2-methoxyethylsulfanyl)-1,3-dihydroindol-2-one (PubChem CID 79345087) has the molecular formula C11H13BrN2O2S and a molecular weight of 317.21 g/mol. Its IUPAC name is 3-amino-5-bromo-6-(2-methoxyethylsulfanyl)-1,3-dihydroindol-2-one.
| Compound Name | 3-amino-5-bromo-6-(2-methoxyethylsulfanyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79345087 |
| Molecular Formula | C11H13BrN2O2S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 3-amino-5-bromo-6-(2-methoxyethylsulfanyl)-1,3-dihydroindol-2-one |
| SMILES | COCCSc1cc2c(cc1Br)C(N)C(=O)N2 |
| InChI | InChI=1S/C11H13BrN2O2S/c1-16-2-3-17-9-5-8-6(4-7(9)12)10(13)11(15)14-8/h4-5,10H,2-3,13H2,1H3,(H,14,15) |
| InChIKey | WCWZMSBPKBFYTM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|