C13H8ClNO3S — CID 79336719
5-chloro-6-(furan-2-ylmethylsulfanyl)-1H-indole-2,3-dione (PubChem CID 79336719) has the molecular formula C13H8ClNO3S and a molecular weight of 293.73 g/mol. Its IUPAC name is 5-chloro-6-(furan-2-ylmethylsulfanyl)-1H-indole-2,3-dione.
| Compound Name | 5-chloro-6-(furan-2-ylmethylsulfanyl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 79336719 |
| Molecular Formula | C13H8ClNO3S |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 5-chloro-6-(furan-2-ylmethylsulfanyl)-1H-indole-2,3-dione |
| SMILES | O=C1Nc2cc(SCc3ccco3)c(Cl)cc2C1=O |
| InChI | InChI=1S/C13H8ClNO3S/c14-9-4-8-10(15-13(17)12(8)16)5-11(9)19-6-7-2-1-3-18-7/h1-5H,6H2,(H,15,16,17) |
| InChIKey | WJASCTZIHBDGGH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|