C11H8Cl2OS — CID 173213846
2-[(2,3-dichlorophenyl)sulfanylmethyl]furan (PubChem CID 173213846) has the molecular formula C11H8Cl2OS and a molecular weight of 259.16 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)sulfanylmethyl]furan.
| Compound Name | 2-[(2,3-dichlorophenyl)sulfanylmethyl]furan |
|---|---|
| PubChem CID | 173213846 |
| Molecular Formula | C11H8Cl2OS |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)sulfanylmethyl]furan |
| SMILES | Clc1cccc(SCc2ccco2)c1Cl |
| InChI | InChI=1S/C11H8Cl2OS/c12-9-4-1-5-10(11(9)13)15-7-8-3-2-6-14-8/h1-6H,7H2 |
| InChIKey | GJWGDBNBIOTAKS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |