C13H13NO3S — CID 28979199
6-(furan-2-ylmethylsulfanyl)-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 28979199) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 6-(furan-2-ylmethylsulfanyl)-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-(furan-2-ylmethylsulfanyl)-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 28979199 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 6-(furan-2-ylmethylsulfanyl)-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Nc1cc2c(cc1SCc1ccco1)OCCO2 |
| InChI | InChI=1S/C13H13NO3S/c14-10-6-11-12(17-5-4-16-11)7-13(10)18-8-9-2-1-3-15-9/h1-3,6-7H,4-5,8,14H2 |
| InChIKey | QVLWXWDVMRMPRA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|