C17H19NO2S — CID 43260346
7-[(2,5-dimethylphenyl)sulfanylmethyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 43260346) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is 7-[(2,5-dimethylphenyl)sulfanylmethyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | 7-[(2,5-dimethylphenyl)sulfanylmethyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 43260346 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 7-[(2,5-dimethylphenyl)sulfanylmethyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | Cc1ccc(C)c(SCc2cc3c(cc2N)OCCO3)c1 |
| InChI | InChI=1S/C17H19NO2S/c1-11-3-4-12(2)17(7-11)21-10-13-8-15-16(9-14(13)18)20-6-5-19-15/h3-4,7-9H,5-6,10,18H2,1-2H3 |
| InChIKey | XETXOCXMTXLQBR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|