C12H21NO2 — CID 79336968
(E)-3-(3,4-dihydro-2H-pyran-2-yl)-N-(2-methoxyethyl)-2-methylprop-2-en-1-amine (PubChem CID 79336968) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (E)-3-(3,4-dihydro-2H-pyran-2-yl)-N-(2-methoxyethyl)-2-methylprop-2-en-1-amine.
| Compound Name | (E)-3-(3,4-dihydro-2H-pyran-2-yl)-N-(2-methoxyethyl)-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 79336968 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (E)-3-(3,4-dihydro-2H-pyran-2-yl)-N-(2-methoxyethyl)-2-methylprop-2-en-1-amine |
| SMILES | COCCNC/C(C)=C/C1CCC=CO1 |
| InChI | InChI=1S/C12H21NO2/c1-11(10-13-6-8-14-2)9-12-5-3-4-7-15-12/h4,7,9,12-13H,3,5-6,8,10H2,1-2H3/b11-9+ |
| InChIKey | YOYLZGHJWBVRGR-PKNBQFBNSA-N |
| XLogP | 1.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|