C14H17N3O2 — CID 79337148
[2-(aminomethyl)cyclopentyl] N-(4-cyanophenyl)carbamate (PubChem CID 79337148) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is [2-(aminomethyl)cyclopentyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [2-(aminomethyl)cyclopentyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 79337148 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | [2-(aminomethyl)cyclopentyl] N-(4-cyanophenyl)carbamate |
| SMILES | N#Cc1ccc(NC(=O)OC2CCCC2CN)cc1 |
| InChI | InChI=1S/C14H17N3O2/c15-8-10-4-6-12(7-5-10)17-14(18)19-13-3-1-2-11(13)9-16/h4-7,11,13H,1-3,9,16H2,(H,17,18) |
| InChIKey | XRVZYBPGALENKA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |