About piperidin-4-yl N-(4-nitrophenyl)carbamate
piperidin-4-yl N-(4-nitrophenyl)carbamate (PubChem CID 79337999) has the molecular formula C12H15N3O4
and a molecular weight of 265.27 g/mol. Its IUPAC name is piperidin-4-yl N-(4-nitrophenyl)carbamate.
Molecular Properties
| Compound Name | piperidin-4-yl N-(4-nitrophenyl)carbamate |
| PubChem CID | 79337999 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | piperidin-4-yl N-(4-nitrophenyl)carbamate |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)OC1CCNCC1 |
| InChI | InChI=1S/C12H15N3O4/c16-12(19-11-5-7-13-8-6-11)14-9-1-3-10(4-2-9)15(17)18/h1-4,11,13H,5-8H2,(H,14,16) |
| InChIKey | XAMIEQOHAXVDNZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze piperidin-4-yl N-(4-nitrophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl N-(4-nitrophenyl)carbamate?
The IUPAC name of piperidin-4-yl N-(4-nitrophenyl)carbamate (CID 79337999) is piperidin-4-yl N-(4-nitrophenyl)carbamate.
What is the SMILES notation for piperidin-4-yl N-(4-nitrophenyl)carbamate?
The canonical SMILES for piperidin-4-yl N-(4-nitrophenyl)carbamate is O=C(Nc1ccc([N+](=O)[O-])cc1)OC1CCNCC1.
What is the InChIKey of piperidin-4-yl N-(4-nitrophenyl)carbamate?
The InChIKey is XAMIEQOHAXVDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O4/c16-12(19-11-5-7-13-8-6-11)14-9-1-3-10(4-2-9)15(17)18/h1-4,11,13H,5-8H2,(H,14,16).
What are the key properties of piperidin-4-yl N-(4-nitrophenyl)carbamate?
piperidin-4-yl N-(4-nitrophenyl)carbamate has a molecular weight of 265.27 g/mol, XLogP of 1.90, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl N-(4-nitrophenyl)carbamate is sourced from PubChem (CID 79337999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).