C15H23NO — CID 79340193
3-(3-ethoxyphenyl)-2-methyl-N-propylprop-2-en-1-amine (PubChem CID 79340193) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 3-(3-ethoxyphenyl)-2-methyl-N-propylprop-2-en-1-amine.
| Compound Name | 3-(3-ethoxyphenyl)-2-methyl-N-propylprop-2-en-1-amine |
|---|---|
| PubChem CID | 79340193 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3-(3-ethoxyphenyl)-2-methyl-N-propylprop-2-en-1-amine |
| SMILES | CCCNCC(C)=Cc1cccc(OCC)c1 |
| InChI | InChI=1S/C15H23NO/c1-4-9-16-12-13(3)10-14-7-6-8-15(11-14)17-5-2/h6-8,10-11,16H,4-5,9,12H2,1-3H3 |
| InChIKey | UDUCPTBZWVZBFN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|