C16H22F3NO — CID 107105341
(2E)-3-methyl-N-propyl-2-[[3-(trifluoromethoxy)phenyl]methylidene]butan-1-amine (PubChem CID 107105341) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is (2E)-3-methyl-N-propyl-2-[[3-(trifluoromethoxy)phenyl]methylidene]butan-1-amine.
| Compound Name | (2E)-3-methyl-N-propyl-2-[[3-(trifluoromethoxy)phenyl]methylidene]butan-1-amine |
|---|---|
| PubChem CID | 107105341 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (2E)-3-methyl-N-propyl-2-[[3-(trifluoromethoxy)phenyl]methylidene]butan-1-amine |
| SMILES | CCCNC/C(=C/c1cccc(OC(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C16H22F3NO/c1-4-8-20-11-14(12(2)3)9-13-6-5-7-15(10-13)21-16(17,18)19/h5-7,9-10,12,20H,4,8,11H2,1-3H3/b14-9- |
| InChIKey | RKBQHUPOEGIRDU-ZROIWOOFSA-N |
| XLogP | 4.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|