C17H29N4OS+ — CID 7934162
1-(2-adamantylideneamino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 7934162) has the molecular formula C17H29N4OS+ and a molecular weight of 337.51 g/mol. Its IUPAC name is 1-(2-adamantylideneamino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-(2-adamantylideneamino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 7934162 |
| Molecular Formula | C17H29N4OS+ |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 1-(2-adamantylideneamino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | S=C(NCC[NH+]1CCOCC1)NN=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H28N4OS/c23-17(18-1-2-21-3-5-22-6-4-21)20-19-16-14-8-12-7-13(10-14)11-15(16)9-12/h12-15H,1-11H2,(H2,18,20,23)/p+1/b19-16- |
| InChIKey | XYSAQBDBBDQUOU-MNDPQUGUSA-O |
| XLogP | 0.18 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|